2,2-difluoroethanol, to air, industrial processes
2,2-difluoroethanol, emissions to air, generated from physical or chemical processes during manufacturing, but not from combustion.
Also known as: 2,2-difluoroethanol; Ethanol, 2,2-difluoro-; 2,2-difluoroethylalcohol; Fd13236; Inchi=1/c2h4f2o/c3-2(4)1-5/h2,5h,1h2; Dtxsid90189459; Mfcd00042248; Chf2ch2oh; Akos000310105; Vogsdfljzpnwhy-uhfffaoysa-; Db-011467; 2,2-difluoro ethanol; Stk263691; Fd2062; 2,2-difluoroethan-1-ol; Cs-0020170; 2,2-difluorethanol; D4128; Chembl4458510; Bcp05861; 670-547-3; Z397587054; 2,2-difluroethanol; 359-13-7; Bbl038231; 2,2-difluoro-ethanol; En300-50881; C2h4f2o; A6246
- Term type: Emission
- Units: kg C2H4F2O
- CAS Number: 359-13-7
References
HESTIA Glossary